Useful Links & Tools
- MSDS
- Specification Sheet
- Certificate of Analysis
- FT-NMR
- Bulk Quote
- Similar Products
Last 5 Products Viewed
W206016
Aldrich
Isoamyl butyrate
natural, ≥98%, 80% isoamyl butyrate basis, FCC, Kosher
| CAS Number: | 106-27-4 |
| Linear Formula: | CH3CH2CH2CO2CH2CH2CH(CH3)2 |
| Molecular Weight: | 158.24 |
| FEMA Number: | 2060 |
| EC Number: | 203-380-8 |
| Council of Europe no.: | 282 |
| MDL number: | MFCD00044888 |
| PubChem Substance ID: | 24900829 |
| Flavis number: | 9.055 |
Description
| Biochem/physiol Actions | Odor at 2.0% |
| Taste at 5 ppm | |
| General description | Natural Occurrence: Melon, papaya, hop oil, grape brandy, bourbon whiskey, honey, jack fruit. |
| Packaging | Packaged in glass bottles |
| F&F Certificates | HALAL Statement |
| Allergen Statement | |
| EU Natural Certificate | |
| US Natural Certificate | |
| GMO Statement | |
| Continuing Guarantee Statement |
Properties
| grade | FCC |
| Halal | |
| Kosher | |
| natural | |
| vapor density | 5.45 (vs air) |
| assay | ≥98% |
| 80% isoamyl butyrate basis | |
| total impurities | 20% 2-methylbutyl butyrate |
| refractive index | n |
| bp | 184-185 °C(lit.) |
| density | 0.862 g/mL at 25 °C(lit.) |
| Organoleptic | apple; banana; berry; honey; hop oil; melon; papaya; tropical; whiskey; green |
Safety
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 1 |
| RTECS | ET5034000 |
| Flash Point(F) | 136 °F |
| Flash Point(C) | 58 °C |
References
| reference | Mosciano, G. P & F 2nd ed., 24, 50, (1999) |
| Merck | Merck 13,5131 |
| Beilstein | Beil. 2,272 |
| Arctander, 137 / FT-NMR 1 (1), 909:C / Fenaroli, 377 |






